C31H32N4O3 — CID 58614526
(E)-N-hydroxy-3-[1-[2-(1H-indol-3-yl)ethyl-(2-phenylethylcarbamoyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide (PubChem CID 58614526) has the molecular formula C31H32N4O3 and a molecular weight of 508.62 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[1-[2-(1H-indol-3-yl)ethyl-(2-phenylethylcarbamoyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[1-[2-(1H-indol-3-yl)ethyl-(2-phenylethylcarbamoyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 58614526 |
| Molecular Formula | C31H32N4O3 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | (E)-N-hydroxy-3-[1-[2-(1H-indol-3-yl)ethyl-(2-phenylethylcarbamoyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)CCC2N(CCc1c[nH]c2ccccc12)C(=O)NCCc1ccccc1)NO |
| InChI | InChI=1S/C31H32N4O3/c36-30(34-38)15-11-23-10-13-27-24(20-23)12-14-29(27)35(31(37)32-18-16-22-6-2-1-3-7-22)19-17-25-21-33-28-9-5-4-8-26(25)28/h1-11,13,15,20-21,29,33,38H,12,14,16-19H2,(H,32,37)(H,34,36)/b15-11+ |
| InChIKey | OSLYDCBXKHPRIL-RVDMUPIBSA-N |
| XLogP | 5.17 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|