C31H28N4O3 — CID 58614103
N-[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-N-[2-(1H-indol-3-yl)ethyl]-1H-indole-2-carboxamide (PubChem CID 58614103) has the molecular formula C31H28N4O3 and a molecular weight of 504.59 g/mol. Its IUPAC name is N-[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-N-[2-(1H-indol-3-yl)ethyl]-1H-indole-2-carboxamide.
| Compound Name | N-[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-N-[2-(1H-indol-3-yl)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 58614103 |
| Molecular Formula | C31H28N4O3 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | N-[5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-N-[2-(1H-indol-3-yl)ethyl]-1H-indole-2-carboxamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)CCC2N(CCc1c[nH]c2ccccc12)C(=O)c1cc2ccccc2[nH]1)NO |
| InChI | InChI=1S/C31H28N4O3/c36-30(34-38)14-10-20-9-12-25-21(17-20)11-13-29(25)35(16-15-23-19-32-27-8-4-2-6-24(23)27)31(37)28-18-22-5-1-3-7-26(22)33-28/h1-10,12,14,17-19,29,32-33,38H,11,13,15-16H2,(H,34,36)/b14-10+ |
| InChIKey | OSSCJHAMDFUZEO-GXDHUFHOSA-N |
| XLogP | 5.54 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|