C28H31N3O4 — CID 91036827
N-[(1R)-5-[3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-N-[(2S)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]cyclobutanecarboxamide (PubChem CID 91036827) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is N-[(1R)-5-[3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-N-[(2S)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]cyclobutanecarboxamide.
| Compound Name | N-[(1R)-5-[3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-N-[(2S)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 91036827 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | N-[(1R)-5-[3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-N-[(2S)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]cyclobutanecarboxamide |
| SMILES | O=C(C=Cc1ccc2c(c1)CC[C@H]2N(C(=O)C1CCC1)[C@H](CO)Cc1c[nH]c2ccccc12)NO |
| InChI | InChI=1S/C28H31N3O4/c32-17-22(15-21-16-29-25-7-2-1-6-23(21)25)31(28(34)19-4-3-5-19)26-12-10-20-14-18(8-11-24(20)26)9-13-27(33)30-35/h1-2,6-9,11,13-14,16,19,22,26,29,32,35H,3-5,10,12,15,17H2,(H,30,33)/t22-,26+/m0/s1 |
| InChIKey | NKVSFLAACCYXDC-BKMJKUGQSA-N |
| XLogP | 3.91 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|