C27H33N5O3 — CID 76838592
N-[2-(dimethylamino)ethyl]-2-[[5-[3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]amino]-3-(1H-indol-3-yl)propanamide (PubChem CID 76838592) has the molecular formula C27H33N5O3 and a molecular weight of 475.59 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-[[5-[3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]amino]-3-(1H-indol-3-yl)propanamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-[[5-[3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]amino]-3-(1H-indol-3-yl)propanamide |
|---|---|
| PubChem CID | 76838592 |
| Molecular Formula | C27H33N5O3 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-[[5-[3-(hydroxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]amino]-3-(1H-indol-3-yl)propanamide |
| SMILES | CN(C)CCNC(=O)C(Cc1c[nH]c2ccccc12)NC1CCc2cc(C=CC(=O)NO)ccc21 |
| InChI | InChI=1S/C27H33N5O3/c1-32(2)14-13-28-27(34)25(16-20-17-29-23-6-4-3-5-21(20)23)30-24-11-9-19-15-18(7-10-22(19)24)8-12-26(33)31-35/h3-8,10,12,15,17,24-25,29-30,35H,9,11,13-14,16H2,1-2H3,(H,28,34)(H,31,33) |
| InChIKey | JPCWJUZCBPCBML-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|