C32H37N5O4S — CID 76838116
3-[1-[[4-[2-(dimethylamino)ethylamino]phenyl]sulfonyl-[2-(1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 76838116) has the molecular formula C32H37N5O4S and a molecular weight of 587.75 g/mol. Its IUPAC name is 3-[1-[[4-[2-(dimethylamino)ethylamino]phenyl]sulfonyl-[2-(1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[1-[[4-[2-(dimethylamino)ethylamino]phenyl]sulfonyl-[2-(1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 76838116 |
| Molecular Formula | C32H37N5O4S |
| Molecular Weight | 587.75 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | 3-[1-[[4-[2-(dimethylamino)ethylamino]phenyl]sulfonyl-[2-(1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | CN(C)CCNc1ccc(S(=O)(=O)N(CCc2c[nH]c3ccccc23)C2CCc3cc(C=CC(=O)NO)ccc32)cc1 |
| InChI | InChI=1S/C32H37N5O4S/c1-36(2)20-18-33-26-10-12-27(13-11-26)42(40,41)37(19-17-25-22-34-30-6-4-3-5-28(25)30)31-15-9-24-21-23(7-14-29(24)31)8-16-32(38)35-39/h3-8,10-14,16,21-22,31,33-34,39H,9,15,17-20H2,1-2H3,(H,35,38) |
| InChIKey | BTMUDNGKCWNKQP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.75 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|