C18H28N2O2 — CID 171080006
ethane;methyl 1-[2-(1H-indol-3-yl)ethyl]pyrrolidine-2-carboxylate;molecular hydrogen (PubChem CID 171080006) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is ethane;methyl 1-[2-(1H-indol-3-yl)ethyl]pyrrolidine-2-carboxylate;molecular hydrogen.
| Compound Name | ethane;methyl 1-[2-(1H-indol-3-yl)ethyl]pyrrolidine-2-carboxylate;molecular hydrogen |
|---|---|
| PubChem CID | 171080006 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | ethane;methyl 1-[2-(1H-indol-3-yl)ethyl]pyrrolidine-2-carboxylate;molecular hydrogen |
| SMILES | CC.COC(=O)C1CCCN1CCc1c[nH]c2ccccc12.[H][H] |
| InChI | InChI=1S/C16H20N2O2.C2H6.H2/c1-20-16(19)15-7-4-9-18(15)10-8-12-11-17-14-6-3-2-5-13(12)14;1-2;/h2-3,5-6,11,15,17H,4,7-10H2,1H3;1-2H3;1H |
| InChIKey | ATZDPQQZGBCHCC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |