C24H26N2O2 — CID 76838115
methyl 3-[5-[2-(1H-indol-3-yl)ethylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enoate (PubChem CID 76838115) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is methyl 3-[5-[2-(1H-indol-3-yl)ethylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enoate.
| Compound Name | methyl 3-[5-[2-(1H-indol-3-yl)ethylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 76838115 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | methyl 3-[5-[2-(1H-indol-3-yl)ethylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccc2c(c1)CCCC2NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H26N2O2/c1-28-24(27)12-10-17-9-11-21-18(15-17)5-4-8-22(21)25-14-13-19-16-26-23-7-3-2-6-20(19)23/h2-3,6-7,9-12,15-16,22,25-26H,4-5,8,13-14H2,1H3 |
| InChIKey | ZAYVYBMLCWBUET-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|