C23H24N2O — CID 155703924
(E)-3-[5-[2-(1H-indol-3-yl)ethylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enal (PubChem CID 155703924) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is (E)-3-[5-[2-(1H-indol-3-yl)ethylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enal.
| Compound Name | (E)-3-[5-[2-(1H-indol-3-yl)ethylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enal |
|---|---|
| PubChem CID | 155703924 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | (E)-3-[5-[2-(1H-indol-3-yl)ethylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enal |
| SMILES | O=C/C=C/c1ccc2c(c1)CCCC2NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H24N2O/c26-14-4-5-17-10-11-21-18(15-17)6-3-9-22(21)24-13-12-19-16-25-23-8-2-1-7-20(19)23/h1-2,4-5,7-8,10-11,14-16,22,24-25H,3,6,9,12-13H2/b5-4+ |
| InChIKey | TWAKCCHXGJBFLM-SNAWJCMRSA-N |
| XLogP | 4.59 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|