C25H29N3O2 — CID 172995437
N-hydroxy-3-[4-[(1R)-1-[2-[(2-methyl-1H-indol-3-yl)methyl]pyrrolidin-1-yl]ethyl]phenyl]prop-2-enamide (PubChem CID 172995437) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is N-hydroxy-3-[4-[(1R)-1-[2-[(2-methyl-1H-indol-3-yl)methyl]pyrrolidin-1-yl]ethyl]phenyl]prop-2-enamide.
| Compound Name | N-hydroxy-3-[4-[(1R)-1-[2-[(2-methyl-1H-indol-3-yl)methyl]pyrrolidin-1-yl]ethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 172995437 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N-hydroxy-3-[4-[(1R)-1-[2-[(2-methyl-1H-indol-3-yl)methyl]pyrrolidin-1-yl]ethyl]phenyl]prop-2-enamide |
| SMILES | Cc1[nH]c2ccccc2c1CC1CCCN1[C@H](C)c1ccc(C=CC(=O)NO)cc1 |
| InChI | InChI=1S/C25H29N3O2/c1-17-23(22-7-3-4-8-24(22)26-17)16-21-6-5-15-28(21)18(2)20-12-9-19(10-13-20)11-14-25(29)27-30/h3-4,7-14,18,21,26,30H,5-6,15-16H2,1-2H3,(H,27,29)/t18-,21?/m1/s1 |
| InChIKey | XHCLPTWIEIYHKP-ITUIMRKVSA-N |
| XLogP | 4.76 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|