C25H35N3O2 — CID 156839616
ethane;(E)-N-hydroxy-3-[4-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]phenyl]prop-2-enamide (PubChem CID 156839616) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is ethane;(E)-N-hydroxy-3-[4-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]phenyl]prop-2-enamide.
| Compound Name | ethane;(E)-N-hydroxy-3-[4-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 156839616 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | ethane;(E)-N-hydroxy-3-[4-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]phenyl]prop-2-enamide |
| SMILES | CC.CC.Cc1[nH]c2ccccc2c1CCNCc1ccc(/C=C/C(=O)NO)cc1 |
| InChI | InChI=1S/C21H23N3O2.2C2H6/c1-15-18(19-4-2-3-5-20(19)23-15)12-13-22-14-17-8-6-16(7-9-17)10-11-21(25)24-26;2*1-2/h2-11,22-23,26H,12-14H2,1H3,(H,24,25);2*1-2H3/b11-10+;; |
| InChIKey | KOPXDHPTXWVOHG-BGNBUWATSA-N |
| XLogP | 5.38 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|