C27H36N4O — CID 155539715
(E)-3-[4-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]phenyl]-N',N'-dipropylprop-2-enehydrazide (PubChem CID 155539715) has the molecular formula C27H36N4O and a molecular weight of 432.61 g/mol. Its IUPAC name is (E)-3-[4-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]phenyl]-N',N'-dipropylprop-2-enehydrazide.
| Compound Name | (E)-3-[4-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]phenyl]-N',N'-dipropylprop-2-enehydrazide |
|---|---|
| PubChem CID | 155539715 |
| Molecular Formula | C27H36N4O |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | (E)-3-[4-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]phenyl]-N',N'-dipropylprop-2-enehydrazide |
| SMILES | CCCN(CCC)NC(=O)/C=C/c1ccc(CNCCc2c(C)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C27H36N4O/c1-4-18-31(19-5-2)30-27(32)15-14-22-10-12-23(13-11-22)20-28-17-16-24-21(3)29-26-9-7-6-8-25(24)26/h6-15,28-29H,4-5,16-20H2,1-3H3,(H,30,32)/b15-14+ |
| InChIKey | QNLMYRBFOJIBQX-CCEZHUSRSA-N |
| XLogP | 4.98 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|