C34H40BN3O4 — CID 142365709
(E)-3-[4-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]phenyl]-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]prop-2-enamide (PubChem CID 142365709) has the molecular formula C34H40BN3O4 and a molecular weight of 565.52 g/mol. Its IUPAC name is (E)-3-[4-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]phenyl]-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]prop-2-enamide.
| Compound Name | (E)-3-[4-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]phenyl]-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]prop-2-enamide |
|---|---|
| PubChem CID | 142365709 |
| Molecular Formula | C34H40BN3O4 |
| Molecular Weight | 565.52 g/mol |
| Exact Mass | 565.31 |
| IUPAC Name | (E)-3-[4-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]phenyl]-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]prop-2-enamide |
| SMILES | Cc1[nH]c2ccccc2c1CCNCc1ccc(/C=C/C(=O)NOCc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)cc1 |
| InChI | InChI=1S/C34H40BN3O4/c1-24-29(30-8-6-7-9-31(30)37-24)20-21-36-22-26-12-10-25(11-13-26)16-19-32(39)38-40-23-27-14-17-28(18-15-27)35-41-33(2,3)34(4,5)42-35/h6-19,36-37H,20-23H2,1-5H3,(H,38,39)/b19-16+ |
| InChIKey | VCPUFMWIAUNZES-KNTRCKAVSA-N |
| XLogP | 5.37 |
| TPSA | 84.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|