C33H38FN3O9 — CID 170158229
2-[(2S,3R,4S,5R,6S)-4,5-diacetyloxy-2-(fluoromethyl)-6-[[(E)-3-[4-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]phenyl]prop-2-enoyl]amino]oxyoxan-3-yl]acetic acid (PubChem CID 170158229) has the molecular formula C33H38FN3O9 and a molecular weight of 639.68 g/mol. Its IUPAC name is 2-[(2S,3R,4S,5R,6S)-4,5-diacetyloxy-2-(fluoromethyl)-6-[[(E)-3-[4-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]phenyl]prop-2-enoyl]amino]oxyoxan-3-yl]acetic acid.
| Compound Name | 2-[(2S,3R,4S,5R,6S)-4,5-diacetyloxy-2-(fluoromethyl)-6-[[(E)-3-[4-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]phenyl]prop-2-enoyl]amino]oxyoxan-3-yl]acetic acid |
|---|---|
| PubChem CID | 170158229 |
| Molecular Formula | C33H38FN3O9 |
| Molecular Weight | 639.68 g/mol |
| Exact Mass | 639.26 |
| IUPAC Name | 2-[(2S,3R,4S,5R,6S)-4,5-diacetyloxy-2-(fluoromethyl)-6-[[(E)-3-[4-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]phenyl]prop-2-enoyl]amino]oxyoxan-3-yl]acetic acid |
| SMILES | CC(=O)O[C@H]1[C@H](ONC(=O)/C=C/c2ccc(CNCCc3c(C)[nH]c4ccccc34)cc2)O[C@H](CF)[C@H](CC(=O)O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C33H38FN3O9/c1-19-24(25-6-4-5-7-27(25)36-19)14-15-35-18-23-10-8-22(9-11-23)12-13-29(40)37-46-33-32(44-21(3)39)31(43-20(2)38)26(16-30(41)42)28(17-34)45-33/h4-13,26,28,31-33,35-36H,14-18H2,1-3H3,(H,37,40)(H,41,42)/b13-12+/t26-,28+,31-,32+,33-/m0/s1 |
| InChIKey | DAOZIMOMSTVOHT-XPXIXYRTSA-N |
| XLogP | 3.52 |
| TPSA | 165.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.68 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|