C31H37N3O7 — CID 170261278
[(2S,3S,4S,6S)-3-acetyloxy-2-methyl-6-[[(E)-3-[4-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]phenyl]prop-2-enoyl]amino]oxyoxan-4-yl] acetate (PubChem CID 170261278) has the molecular formula C31H37N3O7 and a molecular weight of 563.65 g/mol. Its IUPAC name is [(2S,3S,4S,6S)-3-acetyloxy-2-methyl-6-[[(E)-3-[4-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]phenyl]prop-2-enoyl]amino]oxyoxan-4-yl] acetate.
| Compound Name | [(2S,3S,4S,6S)-3-acetyloxy-2-methyl-6-[[(E)-3-[4-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]phenyl]prop-2-enoyl]amino]oxyoxan-4-yl] acetate |
|---|---|
| PubChem CID | 170261278 |
| Molecular Formula | C31H37N3O7 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.26 |
| IUPAC Name | [(2S,3S,4S,6S)-3-acetyloxy-2-methyl-6-[[(E)-3-[4-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]phenyl]prop-2-enoyl]amino]oxyoxan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](C)O[C@@H](ONC(=O)/C=C/c2ccc(CNCCc3c(C)[nH]c4ccccc34)cc2)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C31H37N3O7/c1-19-25(26-7-5-6-8-27(26)33-19)15-16-32-18-24-11-9-23(10-12-24)13-14-29(37)34-41-30-17-28(39-21(3)35)31(20(2)38-30)40-22(4)36/h5-14,20,28,30-33H,15-18H2,1-4H3,(H,34,37)/b14-13+/t20-,28-,30-,31-/m0/s1 |
| InChIKey | IHZVUOQBUFGYSL-MQVJFHOLSA-N |
| XLogP | 3.87 |
| TPSA | 127.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|