C27H33N3O3 — CID 176902737
(E)-3-[2-methyl-4-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]phenyl]-N-(oxan-2-yloxy)prop-2-enamide (PubChem CID 176902737) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is (E)-3-[2-methyl-4-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]phenyl]-N-(oxan-2-yloxy)prop-2-enamide.
| Compound Name | (E)-3-[2-methyl-4-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]phenyl]-N-(oxan-2-yloxy)prop-2-enamide |
|---|---|
| PubChem CID | 176902737 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | (E)-3-[2-methyl-4-[[2-(2-methyl-1H-indol-3-yl)ethylamino]methyl]phenyl]-N-(oxan-2-yloxy)prop-2-enamide |
| SMILES | Cc1cc(CNCCc2c(C)[nH]c3ccccc23)ccc1/C=C/C(=O)NOC1CCCCO1 |
| InChI | InChI=1S/C27H33N3O3/c1-19-17-21(18-28-15-14-23-20(2)29-25-8-4-3-7-24(23)25)10-11-22(19)12-13-26(31)30-33-27-9-5-6-16-32-27/h3-4,7-8,10-13,17,27-29H,5-6,9,14-16,18H2,1-2H3,(H,30,31)/b13-12+ |
| InChIKey | HWZYIWAXCPCVBD-OUKQBFOZSA-N |
| XLogP | 4.70 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|