C21H22AsN2O2 — CID 87691051
CID 87691051 (PubChem CID 87691051) has the molecular formula C21H22AsN2O2 and a molecular weight of 409.34 g/mol.
| Compound Name | CID 87691051 |
|---|---|
| PubChem CID | 87691051 |
| Molecular Formula | C21H22AsN2O2 |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | — |
| SMILES | Cc1[nH]c2ccccc2c1CC[As]Cc1ccc(/C=C/C(=O)NO)cc1 |
| InChI | InChI=1S/C21H22AsN2O2/c1-15-18(19-4-2-3-5-20(19)23-15)12-13-22-14-17-8-6-16(7-9-17)10-11-21(25)24-26/h2-11,23,26H,12-14H2,1H3,(H,24,25)/b11-10+ |
| InChIKey | NLXZHMRXCKVFAP-ZHACJKMWSA-N |
| XLogP | 3.86 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|