C39H42N4O4 — CID 162293551
(E)-N-hydroxy-3-[4-(2-pyridin-2-ylethoxy)phenyl]prop-2-enamide;(E)-N-methyl-3-[4-[4-(2-methyl-1H-indol-3-yl)butyl]phenyl]prop-2-enamide (PubChem CID 162293551) has the molecular formula C39H42N4O4 and a molecular weight of 630.79 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[4-(2-pyridin-2-ylethoxy)phenyl]prop-2-enamide;(E)-N-methyl-3-[4-[4-(2-methyl-1H-indol-3-yl)butyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[4-(2-pyridin-2-ylethoxy)phenyl]prop-2-enamide;(E)-N-methyl-3-[4-[4-(2-methyl-1H-indol-3-yl)butyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 162293551 |
| Molecular Formula | C39H42N4O4 |
| Molecular Weight | 630.79 g/mol |
| Exact Mass | 630.32 |
| IUPAC Name | (E)-N-hydroxy-3-[4-(2-pyridin-2-ylethoxy)phenyl]prop-2-enamide;(E)-N-methyl-3-[4-[4-(2-methyl-1H-indol-3-yl)butyl]phenyl]prop-2-enamide |
| SMILES | CNC(=O)/C=C/c1ccc(CCCCc2c(C)[nH]c3ccccc23)cc1.O=C(/C=C/c1ccc(OCCc2ccccn2)cc1)NO |
| InChI | InChI=1S/C23H26N2O.C16H16N2O3/c1-17-20(21-9-5-6-10-22(21)25-17)8-4-3-7-18-11-13-19(14-12-18)15-16-23(26)24-2;19-16(18-20)9-6-13-4-7-15(8-5-13)21-12-10-14-3-1-2-11-17-14/h5-6,9-16,25H,3-4,7-8H2,1-2H3,(H,24,26);1-9,11,20H,10,12H2,(H,18,19)/b16-15+;9-6+ |
| InChIKey | KJYRPVLTVYXOJG-NRBXGSENSA-N |
| XLogP | 7.02 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.79 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|