C26H37N3O2 — CID 144858739
(E)-3-[4-[[2-(2,3-dimethyl-1H-indol-5-yl)ethylamino]methyl]phenyl]-N-hydroxyprop-2-enamide;ethane (PubChem CID 144858739) has the molecular formula C26H37N3O2 and a molecular weight of 423.60 g/mol. Its IUPAC name is (E)-3-[4-[[2-(2,3-dimethyl-1H-indol-5-yl)ethylamino]methyl]phenyl]-N-hydroxyprop-2-enamide;ethane.
| Compound Name | (E)-3-[4-[[2-(2,3-dimethyl-1H-indol-5-yl)ethylamino]methyl]phenyl]-N-hydroxyprop-2-enamide;ethane |
|---|---|
| PubChem CID | 144858739 |
| Molecular Formula | C26H37N3O2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | (E)-3-[4-[[2-(2,3-dimethyl-1H-indol-5-yl)ethylamino]methyl]phenyl]-N-hydroxyprop-2-enamide;ethane |
| SMILES | CC.CC.Cc1[nH]c2ccc(CCNCc3ccc(/C=C/C(=O)NO)cc3)cc2c1C |
| InChI | InChI=1S/C22H25N3O2.2C2H6/c1-15-16(2)24-21-9-7-18(13-20(15)21)11-12-23-14-19-5-3-17(4-6-19)8-10-22(26)25-27;2*1-2/h3-10,13,23-24,27H,11-12,14H2,1-2H3,(H,25,26);2*1-2H3/b10-8+;; |
| InChIKey | LYQZSDAKFCDSDF-PIHABLKOSA-N |
| XLogP | 5.69 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|