C26H30N2O3 — CID 11122616
methyl (E)-3-[4-[[2-(1H-indol-3-yl)ethyl-(oxan-4-yl)amino]methyl]phenyl]prop-2-enoate (PubChem CID 11122616) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is methyl (E)-3-[4-[[2-(1H-indol-3-yl)ethyl-(oxan-4-yl)amino]methyl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[[2-(1H-indol-3-yl)ethyl-(oxan-4-yl)amino]methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 11122616 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | methyl (E)-3-[4-[[2-(1H-indol-3-yl)ethyl-(oxan-4-yl)amino]methyl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(CN(CCc2c[nH]c3ccccc23)C2CCOCC2)cc1 |
| InChI | InChI=1S/C26H30N2O3/c1-30-26(29)11-10-20-6-8-21(9-7-20)19-28(23-13-16-31-17-14-23)15-12-22-18-27-25-5-3-2-4-24(22)25/h2-11,18,23,27H,12-17,19H2,1H3/b11-10+ |
| InChIKey | GVZFMPZIYXCQHE-ZHACJKMWSA-N |
| XLogP | 4.58 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|