C16H22N2O2 — CID 103254743
methyl (E)-3-[(1-benzylpiperidin-3-yl)amino]prop-2-enoate (PubChem CID 103254743) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is methyl (E)-3-[(1-benzylpiperidin-3-yl)amino]prop-2-enoate.
| Compound Name | methyl (E)-3-[(1-benzylpiperidin-3-yl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 103254743 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | methyl (E)-3-[(1-benzylpiperidin-3-yl)amino]prop-2-enoate |
| SMILES | COC(=O)/C=C/NC1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C16H22N2O2/c1-20-16(19)9-10-17-15-8-5-11-18(13-15)12-14-6-3-2-4-7-14/h2-4,6-7,9-10,15,17H,5,8,11-13H2,1H3/b10-9+ |
| InChIKey | SRFHFGKGQPXQIW-MDZDMXLPSA-N |
| XLogP | 1.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|