C29H27NO3S — CID 67051203
methyl 3-[4-[[4-(8-oxo-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-2-ylidene)piperidin-1-yl]methyl]phenyl]prop-2-enoate (PubChem CID 67051203) has the molecular formula C29H27NO3S and a molecular weight of 469.61 g/mol. Its IUPAC name is methyl 3-[4-[[4-(8-oxo-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-2-ylidene)piperidin-1-yl]methyl]phenyl]prop-2-enoate.
| Compound Name | methyl 3-[4-[[4-(8-oxo-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-2-ylidene)piperidin-1-yl]methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 67051203 |
| Molecular Formula | C29H27NO3S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | methyl 3-[4-[[4-(8-oxo-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-2-ylidene)piperidin-1-yl]methyl]phenyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccc(CN2CCC(=C3c4ccccc4CC(=O)c4sccc43)CC2)cc1 |
| InChI | InChI=1S/C29H27NO3S/c1-33-27(32)11-10-20-6-8-21(9-7-20)19-30-15-12-22(13-16-30)28-24-5-3-2-4-23(24)18-26(31)29-25(28)14-17-34-29/h2-11,14,17H,12-13,15-16,18-19H2,1H3 |
| InChIKey | DCZYLYOFDMJQPS-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|