C30H31N2O5S+ — CID 74762833
(E)-but-2-enedioic acid;2-[1-methyl-1-[(4-methyl-3-pyridinyl)methyl]piperidin-1-ium-4-ylidene]-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one (PubChem CID 74762833) has the molecular formula C30H31N2O5S+ and a molecular weight of 531.65 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-[1-methyl-1-[(4-methyl-3-pyridinyl)methyl]piperidin-1-ium-4-ylidene]-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one.
| Compound Name | (E)-but-2-enedioic acid;2-[1-methyl-1-[(4-methyl-3-pyridinyl)methyl]piperidin-1-ium-4-ylidene]-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one |
|---|---|
| PubChem CID | 74762833 |
| Molecular Formula | C30H31N2O5S+ |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | (E)-but-2-enedioic acid;2-[1-methyl-1-[(4-methyl-3-pyridinyl)methyl]piperidin-1-ium-4-ylidene]-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one |
| SMILES | Cc1ccncc1C[N+]1(C)CCC(=C2c3ccccc3CC(=O)c3sccc32)CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C26H27N2OS.C4H4O4/c1-18-7-11-27-16-21(18)17-28(2)12-8-19(9-13-28)25-22-6-4-3-5-20(22)15-24(29)26-23(25)10-14-30-26;5-3(6)1-2-4(7)8/h3-7,10-11,14,16H,8-9,12-13,15,17H2,1-2H3;1-2H,(H,5,6)(H,7,8)/q+1;/b25-19-;2-1+ |
| InChIKey | GCZKVRJIRLVINY-VRNTVWTISA-N |
| XLogP | 5.14 |
| TPSA | 104.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|