C26H28N2OS — CID 135224748
2-[1-[(2E)-4-methyl-2-[(methylideneamino)methylidene]pent-3-enyl]piperidin-4-ylidene]-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one (PubChem CID 135224748) has the molecular formula C26H28N2OS and a molecular weight of 416.59 g/mol. Its IUPAC name is 2-[1-[(2E)-4-methyl-2-[(methylideneamino)methylidene]pent-3-enyl]piperidin-4-ylidene]-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one.
| Compound Name | 2-[1-[(2E)-4-methyl-2-[(methylideneamino)methylidene]pent-3-enyl]piperidin-4-ylidene]-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one |
|---|---|
| PubChem CID | 135224748 |
| Molecular Formula | C26H28N2OS |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 2-[1-[(2E)-4-methyl-2-[(methylideneamino)methylidene]pent-3-enyl]piperidin-4-ylidene]-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one |
| SMILES | C=N/C=C(\C=C(C)C)CN1CCC(=C2c3ccccc3CC(=O)c3sccc32)CC1 |
| InChI | InChI=1S/C26H28N2OS/c1-18(2)14-19(16-27-3)17-28-11-8-20(9-12-28)25-22-7-5-4-6-21(22)15-24(29)26-23(25)10-13-30-26/h4-7,10,13-14,16H,3,8-9,11-12,15,17H2,1-2H3/b19-16+ |
| InChIKey | ADLAYUIMIXCXRE-KNTRCKAVSA-N |
| XLogP | 5.94 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|