C28H26N2O3S — CID 75596412
N-hydroxy-3-[4-[[4-(8-oxo-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-2-ylidene)piperidin-1-yl]methyl]phenyl]prop-2-enamide (PubChem CID 75596412) has the molecular formula C28H26N2O3S and a molecular weight of 470.59 g/mol. Its IUPAC name is N-hydroxy-3-[4-[[4-(8-oxo-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-2-ylidene)piperidin-1-yl]methyl]phenyl]prop-2-enamide.
| Compound Name | N-hydroxy-3-[4-[[4-(8-oxo-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-2-ylidene)piperidin-1-yl]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 75596412 |
| Molecular Formula | C28H26N2O3S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | N-hydroxy-3-[4-[[4-(8-oxo-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-2-ylidene)piperidin-1-yl]methyl]phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(CN2CCC(=C3c4ccccc4CC(=O)c4sccc43)CC2)cc1)NO |
| InChI | InChI=1S/C28H26N2O3S/c31-25-17-22-3-1-2-4-23(22)27(24-13-16-34-28(24)25)21-11-14-30(15-12-21)18-20-7-5-19(6-8-20)9-10-26(32)29-33/h1-10,13,16,33H,11-12,14-15,17-18H2,(H,29,32) |
| InChIKey | BMSLLCPJIZZVIO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|