C25H34O4 — CID 147653880
cyclopentyl (2S)-2-cyclohexyl-4-[3-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]butanoate (PubChem CID 147653880) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is cyclopentyl (2S)-2-cyclohexyl-4-[3-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]butanoate.
| Compound Name | cyclopentyl (2S)-2-cyclohexyl-4-[3-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]butanoate |
|---|---|
| PubChem CID | 147653880 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | cyclopentyl (2S)-2-cyclohexyl-4-[3-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]butanoate |
| SMILES | O=C(/C=C/c1cccc(CC[C@H](C(=O)OC2CCCC2)C2CCCCC2)c1)CO |
| InChI | InChI=1S/C25H34O4/c26-18-22(27)15-13-19-7-6-8-20(17-19)14-16-24(21-9-2-1-3-10-21)25(28)29-23-11-4-5-12-23/h6-8,13,15,17,21,23-24,26H,1-5,9-12,14,16,18H2/b15-13+/t24-/m0/s1 |
| InChIKey | GKANFGHNVLAWSZ-RQOTYCFOSA-N |
| XLogP | 4.88 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|