C32H48N2O4 — CID 158123320
cyclopentyl (2S)-2-cyclohexyl-4-[4-[[[3-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]methyl]cyclohexyl]butanoate (PubChem CID 158123320) has the molecular formula C32H48N2O4 and a molecular weight of 524.75 g/mol. Its IUPAC name is cyclopentyl (2S)-2-cyclohexyl-4-[4-[[[3-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]methyl]cyclohexyl]butanoate.
| Compound Name | cyclopentyl (2S)-2-cyclohexyl-4-[4-[[[3-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]methyl]cyclohexyl]butanoate |
|---|---|
| PubChem CID | 158123320 |
| Molecular Formula | C32H48N2O4 |
| Molecular Weight | 524.75 g/mol |
| Exact Mass | 524.36 |
| IUPAC Name | cyclopentyl (2S)-2-cyclohexyl-4-[4-[[[3-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]methyl]cyclohexyl]butanoate |
| SMILES | O=C(/C=C/c1cccc(CNCC2CCC(CC[C@H](C(=O)OC3CCCC3)C3CCCCC3)CC2)c1)NO |
| InChI | InChI=1S/C32H48N2O4/c35-31(34-37)20-18-25-7-6-8-27(21-25)23-33-22-26-15-13-24(14-16-26)17-19-30(28-9-2-1-3-10-28)32(36)38-29-11-4-5-12-29/h6-8,18,20-21,24,26,28-30,33,37H,1-5,9-17,19,22-23H2,(H,34,35)/b20-18+/t24?,26?,30-/m0/s1 |
| InChIKey | JZNYLNORAWUURF-AVNSATENSA-N |
| XLogP | 6.56 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.75 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|