C25H30N2O4 — CID 46892115
cyclopentyl (2S)-2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]-2-methyl-3-phenylpropanoate (PubChem CID 46892115) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is cyclopentyl (2S)-2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]-2-methyl-3-phenylpropanoate.
| Compound Name | cyclopentyl (2S)-2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]-2-methyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 46892115 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | cyclopentyl (2S)-2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]-2-methyl-3-phenylpropanoate |
| SMILES | C[C@@](Cc1ccccc1)(NCc1ccc(/C=C/C(=O)NO)cc1)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C25H30N2O4/c1-25(17-20-7-3-2-4-8-20,24(29)31-22-9-5-6-10-22)26-18-21-13-11-19(12-14-21)15-16-23(28)27-30/h2-4,7-8,11-16,22,26,30H,5-6,9-10,17-18H2,1H3,(H,27,28)/b16-15+/t25-/m0/s1 |
| InChIKey | FTRSZRYQNPOYTA-DACFSCGWSA-N |
| XLogP | 3.78 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|