C22H32N2O5 — CID 87239840
cyclopentyl (2R)-2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate (PubChem CID 87239840) has the molecular formula C22H32N2O5 and a molecular weight of 404.51 g/mol. Its IUPAC name is cyclopentyl (2R)-2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate.
| Compound Name | cyclopentyl (2R)-2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate |
|---|---|
| PubChem CID | 87239840 |
| Molecular Formula | C22H32N2O5 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | cyclopentyl (2R)-2-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate |
| SMILES | CC(C)(C)OC[C@@H](NCc1ccc(/C=C/C(=O)NO)cc1)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C22H32N2O5/c1-22(2,3)28-15-19(21(26)29-18-6-4-5-7-18)23-14-17-10-8-16(9-11-17)12-13-20(25)24-27/h8-13,18-19,23,27H,4-7,14-15H2,1-3H3,(H,24,25)/b13-12+/t19-/m1/s1 |
| InChIKey | NSFOWBNWEPABJN-JXOMPUQVSA-N |
| XLogP | 2.96 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|