C24H34N2O4 — CID 123605470
(3-methylcyclopentyl) (2S)-2-cyclohexyl-2-[[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]acetate (PubChem CID 123605470) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is (3-methylcyclopentyl) (2S)-2-cyclohexyl-2-[[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]acetate.
| Compound Name | (3-methylcyclopentyl) (2S)-2-cyclohexyl-2-[[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]acetate |
|---|---|
| PubChem CID | 123605470 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | (3-methylcyclopentyl) (2S)-2-cyclohexyl-2-[[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]acetate |
| SMILES | CC1CCC(OC(=O)[C@@H](NCc2ccc(C=CC(=O)NO)cc2)C2CCCCC2)C1 |
| InChI | InChI=1S/C24H34N2O4/c1-17-7-13-21(15-17)30-24(28)23(20-5-3-2-4-6-20)25-16-19-10-8-18(9-11-19)12-14-22(27)26-29/h8-12,14,17,20-21,23,25,29H,2-7,13,15-16H2,1H3,(H,26,27)/t17?,21?,23-/m0/s1 |
| InChIKey | VRHRJSSQXYERJK-WJXHAUQLSA-N |
| XLogP | 3.98 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|