C31H42N2O5 — CID 159925279
cyclopentyl (2S)-2-[[4-[3-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]propyl]phenyl]methylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate (PubChem CID 159925279) has the molecular formula C31H42N2O5 and a molecular weight of 522.69 g/mol. Its IUPAC name is cyclopentyl (2S)-2-[[4-[3-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]propyl]phenyl]methylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate.
| Compound Name | cyclopentyl (2S)-2-[[4-[3-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]propyl]phenyl]methylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate |
|---|---|
| PubChem CID | 159925279 |
| Molecular Formula | C31H42N2O5 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.31 |
| IUPAC Name | cyclopentyl (2S)-2-[[4-[3-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]propyl]phenyl]methylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate |
| SMILES | CC(C)(C)OC[C@H](NCc1ccc(CCCc2ccc(/C=C/C(=O)NO)cc2)cc1)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C31H42N2O5/c1-31(2,3)37-22-28(30(35)38-27-9-4-5-10-27)32-21-26-17-15-24(16-18-26)8-6-7-23-11-13-25(14-12-23)19-20-29(34)33-36/h11-20,27-28,32,36H,4-10,21-22H2,1-3H3,(H,33,34)/b20-19+/t28-/m0/s1 |
| InChIKey | CEYCHCAAKWXMOQ-PDRZGFNUSA-N |
| XLogP | 5.14 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|