C29H44N2O5 — CID 91577214
cyclopentyl (2S)-2-cyclohexyl-2-[[3-[3-[1-(2-methylpropoxy)ethoxyamino]-3-oxoprop-1-enyl]phenyl]methylamino]acetate (PubChem CID 91577214) has the molecular formula C29H44N2O5 and a molecular weight of 500.68 g/mol. Its IUPAC name is cyclopentyl (2S)-2-cyclohexyl-2-[[3-[3-[1-(2-methylpropoxy)ethoxyamino]-3-oxoprop-1-enyl]phenyl]methylamino]acetate.
| Compound Name | cyclopentyl (2S)-2-cyclohexyl-2-[[3-[3-[1-(2-methylpropoxy)ethoxyamino]-3-oxoprop-1-enyl]phenyl]methylamino]acetate |
|---|---|
| PubChem CID | 91577214 |
| Molecular Formula | C29H44N2O5 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | cyclopentyl (2S)-2-cyclohexyl-2-[[3-[3-[1-(2-methylpropoxy)ethoxyamino]-3-oxoprop-1-enyl]phenyl]methylamino]acetate |
| SMILES | CC(C)COC(C)ONC(=O)C=Cc1cccc(CN[C@H](C(=O)OC2CCCC2)C2CCCCC2)c1 |
| InChI | InChI=1S/C29H44N2O5/c1-21(2)20-34-22(3)36-31-27(32)17-16-23-10-9-11-24(18-23)19-30-28(25-12-5-4-6-13-25)29(33)35-26-14-7-8-15-26/h9-11,16-18,21-22,25-26,28,30H,4-8,12-15,19-20H2,1-3H3,(H,31,32)/t22?,28-/m0/s1 |
| InChIKey | XLPRRZDGXXPAQK-WNWQKLGWSA-N |
| XLogP | 5.29 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|