C24H34N2O6 — CID 173100558
(2S)-2-cyclohexyl-2-[[3-[3-[1-(2-methylpropoxy)ethoxyamino]-3-oxoprop-1-enyl]benzoyl]amino]acetic acid (PubChem CID 173100558) has the molecular formula C24H34N2O6 and a molecular weight of 446.54 g/mol. Its IUPAC name is (2S)-2-cyclohexyl-2-[[3-[3-[1-(2-methylpropoxy)ethoxyamino]-3-oxoprop-1-enyl]benzoyl]amino]acetic acid.
| Compound Name | (2S)-2-cyclohexyl-2-[[3-[3-[1-(2-methylpropoxy)ethoxyamino]-3-oxoprop-1-enyl]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 173100558 |
| Molecular Formula | C24H34N2O6 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | (2S)-2-cyclohexyl-2-[[3-[3-[1-(2-methylpropoxy)ethoxyamino]-3-oxoprop-1-enyl]benzoyl]amino]acetic acid |
| SMILES | CC(C)COC(C)ONC(=O)C=Cc1cccc(C(=O)N[C@H](C(=O)O)C2CCCCC2)c1 |
| InChI | InChI=1S/C24H34N2O6/c1-16(2)15-31-17(3)32-26-21(27)13-12-18-8-7-11-20(14-18)23(28)25-22(24(29)30)19-9-5-4-6-10-19/h7-8,11-14,16-17,19,22H,4-6,9-10,15H2,1-3H3,(H,25,28)(H,26,27)(H,29,30)/t17?,22-/m0/s1 |
| InChIKey | CRSXNPQFCNKQHK-UGNFMNBCSA-N |
| XLogP | 3.53 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|