C26H40N2O6 — CID 173100552
(2S)-2-cyclohexyl-2-[3-[4-[3-[1-(2-methylpropoxy)ethoxyamino]-3-oxoprop-1-enyl]phenoxy]propylamino]acetic acid (PubChem CID 173100552) has the molecular formula C26H40N2O6 and a molecular weight of 476.61 g/mol. Its IUPAC name is (2S)-2-cyclohexyl-2-[3-[4-[3-[1-(2-methylpropoxy)ethoxyamino]-3-oxoprop-1-enyl]phenoxy]propylamino]acetic acid.
| Compound Name | (2S)-2-cyclohexyl-2-[3-[4-[3-[1-(2-methylpropoxy)ethoxyamino]-3-oxoprop-1-enyl]phenoxy]propylamino]acetic acid |
|---|---|
| PubChem CID | 173100552 |
| Molecular Formula | C26H40N2O6 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | (2S)-2-cyclohexyl-2-[3-[4-[3-[1-(2-methylpropoxy)ethoxyamino]-3-oxoprop-1-enyl]phenoxy]propylamino]acetic acid |
| SMILES | CC(C)COC(C)ONC(=O)C=Cc1ccc(OCCCN[C@H](C(=O)O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C26H40N2O6/c1-19(2)18-33-20(3)34-28-24(29)15-12-21-10-13-23(14-11-21)32-17-7-16-27-25(26(30)31)22-8-5-4-6-9-22/h10-15,19-20,22,25,27H,4-9,16-18H2,1-3H3,(H,28,29)(H,30,31)/t20?,25-/m0/s1 |
| InChIKey | UNYCVPYLIVREQY-KUXBLMNESA-N |
| XLogP | 4.16 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|