C30H37N3O4S — CID 76677932
cyclopentyl 2-cyclohexyl-2-[[3-[[2-(hydroxycarbamoyl)-1-benzothiophen-6-yl]methylamino]phenyl]methylamino]acetate (PubChem CID 76677932) has the molecular formula C30H37N3O4S and a molecular weight of 535.71 g/mol. Its IUPAC name is cyclopentyl 2-cyclohexyl-2-[[3-[[2-(hydroxycarbamoyl)-1-benzothiophen-6-yl]methylamino]phenyl]methylamino]acetate.
| Compound Name | cyclopentyl 2-cyclohexyl-2-[[3-[[2-(hydroxycarbamoyl)-1-benzothiophen-6-yl]methylamino]phenyl]methylamino]acetate |
|---|---|
| PubChem CID | 76677932 |
| Molecular Formula | C30H37N3O4S |
| Molecular Weight | 535.71 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | cyclopentyl 2-cyclohexyl-2-[[3-[[2-(hydroxycarbamoyl)-1-benzothiophen-6-yl]methylamino]phenyl]methylamino]acetate |
| SMILES | O=C(NO)c1cc2ccc(CNc3cccc(CNC(C(=O)OC4CCCC4)C4CCCCC4)c3)cc2s1 |
| InChI | InChI=1S/C30H37N3O4S/c34-29(33-36)27-17-23-14-13-21(16-26(23)38-27)18-31-24-10-6-7-20(15-24)19-32-28(22-8-2-1-3-9-22)30(35)37-25-11-4-5-12-25/h6-7,10,13-17,22,25,28,31-32,36H,1-5,8-9,11-12,18-19H2,(H,33,34) |
| InChIKey | JGOAZYSUWCPSTN-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.71 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|