C34H55N3O6 — CID 86636514
cyclopentyl (2S)-2-cyclohexyl-2-[[4-[[8-[1-(2-methylpropoxy)ethoxyamino]-8-oxooctanoyl]amino]phenyl]methylamino]acetate (PubChem CID 86636514) has the molecular formula C34H55N3O6 and a molecular weight of 601.83 g/mol. Its IUPAC name is cyclopentyl (2S)-2-cyclohexyl-2-[[4-[[8-[1-(2-methylpropoxy)ethoxyamino]-8-oxooctanoyl]amino]phenyl]methylamino]acetate.
| Compound Name | cyclopentyl (2S)-2-cyclohexyl-2-[[4-[[8-[1-(2-methylpropoxy)ethoxyamino]-8-oxooctanoyl]amino]phenyl]methylamino]acetate |
|---|---|
| PubChem CID | 86636514 |
| Molecular Formula | C34H55N3O6 |
| Molecular Weight | 601.83 g/mol |
| Exact Mass | 601.41 |
| IUPAC Name | cyclopentyl (2S)-2-cyclohexyl-2-[[4-[[8-[1-(2-methylpropoxy)ethoxyamino]-8-oxooctanoyl]amino]phenyl]methylamino]acetate |
| SMILES | CC(C)COC(C)ONC(=O)CCCCCCC(=O)Nc1ccc(CN[C@H](C(=O)OC2CCCC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C34H55N3O6/c1-25(2)24-41-26(3)43-37-32(39)18-10-5-4-9-17-31(38)36-29-21-19-27(20-22-29)23-35-33(28-13-7-6-8-14-28)34(40)42-30-15-11-12-16-30/h19-22,25-26,28,30,33,35H,4-18,23-24H2,1-3H3,(H,36,38)(H,37,39)/t26?,33-/m0/s1 |
| InChIKey | OWGRHCRBOYMUNX-VKPSHWPRSA-N |
| XLogP | 6.56 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.83 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|