C29H41N3O5 — CID 139439369
cyclopentyl (2S)-2-[[3-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]methylamino]-2-(6-methylcyclohexa-2,4-dien-1-yl)acetate (PubChem CID 139439369) has the molecular formula C29H41N3O5 and a molecular weight of 511.66 g/mol. Its IUPAC name is cyclopentyl (2S)-2-[[3-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]methylamino]-2-(6-methylcyclohexa-2,4-dien-1-yl)acetate.
| Compound Name | cyclopentyl (2S)-2-[[3-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]methylamino]-2-(6-methylcyclohexa-2,4-dien-1-yl)acetate |
|---|---|
| PubChem CID | 139439369 |
| Molecular Formula | C29H41N3O5 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.30 |
| IUPAC Name | cyclopentyl (2S)-2-[[3-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]methylamino]-2-(6-methylcyclohexa-2,4-dien-1-yl)acetate |
| SMILES | CC1C=CC=CC1[C@H](NCc1cccc(NC(=O)CCCCCCC(=O)NO)c1)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C29H41N3O5/c1-21-11-6-9-16-25(21)28(29(35)37-24-14-7-8-15-24)30-20-22-12-10-13-23(19-22)31-26(33)17-4-2-3-5-18-27(34)32-36/h6,9-13,16,19,21,24-25,28,30,36H,2-5,7-8,14-15,17-18,20H2,1H3,(H,31,33)(H,32,34)/t21?,25?,28-/m0/s1 |
| InChIKey | LQIWPACAAUNZAU-SPTTVWGDSA-N |
| XLogP | 4.79 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|