C23H33N3O5 — CID 139439249
(Z,2S,3E)-3-ethylidene-2-[[3-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]methylamino]hex-4-enoic acid (PubChem CID 139439249) has the molecular formula C23H33N3O5 and a molecular weight of 431.53 g/mol. Its IUPAC name is (Z,2S,3E)-3-ethylidene-2-[[3-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]methylamino]hex-4-enoic acid.
| Compound Name | (Z,2S,3E)-3-ethylidene-2-[[3-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]methylamino]hex-4-enoic acid |
|---|---|
| PubChem CID | 139439249 |
| Molecular Formula | C23H33N3O5 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | (Z,2S,3E)-3-ethylidene-2-[[3-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]methylamino]hex-4-enoic acid |
| SMILES | C/C=C\C(=C/C)[C@H](NCc1cccc(NC(=O)CCCCCCC(=O)NO)c1)C(=O)O |
| InChI | InChI=1S/C23H33N3O5/c1-3-10-18(4-2)22(23(29)30)24-16-17-11-9-12-19(15-17)25-20(27)13-7-5-6-8-14-21(28)26-31/h3-4,9-12,15,22,24,31H,5-8,13-14,16H2,1-2H3,(H,25,27)(H,26,28)(H,29,30)/b10-3-,18-4+/t22-/m0/s1 |
| InChIKey | HTGBZGVVDVOOPS-AZGFRAGVSA-N |
| XLogP | 3.54 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|