C23H29N3O5 — CID 73201416
2-[[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]methylamino]-2-phenylacetic acid (PubChem CID 73201416) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-[[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]methylamino]-2-phenylacetic acid.
| Compound Name | 2-[[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]methylamino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 73201416 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 2-[[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]methylamino]-2-phenylacetic acid |
| SMILES | O=C(CCCCCCC(=O)Nc1ccc(CNC(C(=O)O)c2ccccc2)cc1)NO |
| InChI | InChI=1S/C23H29N3O5/c27-20(10-6-1-2-7-11-21(28)26-31)25-19-14-12-17(13-15-19)16-24-22(23(29)30)18-8-4-3-5-9-18/h3-5,8-9,12-15,22,24,31H,1-2,6-7,10-11,16H2,(H,25,27)(H,26,28)(H,29,30) |
| InChIKey | BKOTWGYGBLTPKM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|