C39H56N4O10 — CID 163974356
bis[[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]methyl] 4,4-dimethylheptanedioate (PubChem CID 163974356) has the molecular formula C39H56N4O10 and a molecular weight of 740.90 g/mol. Its IUPAC name is bis[[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]methyl] 4,4-dimethylheptanedioate.
| Compound Name | bis[[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]methyl] 4,4-dimethylheptanedioate |
|---|---|
| PubChem CID | 163974356 |
| Molecular Formula | C39H56N4O10 |
| Molecular Weight | 740.90 g/mol |
| Exact Mass | 740.40 |
| IUPAC Name | bis[[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]methyl] 4,4-dimethylheptanedioate |
| SMILES | CC(C)(CCC(=O)OCc1ccc(NC(=O)CCCCCCC(=O)NO)cc1)CCC(=O)OCc1ccc(NC(=O)CCCCCCC(=O)NO)cc1 |
| InChI | InChI=1S/C39H56N4O10/c1-39(2,25-23-37(48)52-27-29-15-19-31(20-16-29)40-33(44)11-7-3-5-9-13-35(46)42-50)26-24-38(49)53-28-30-17-21-32(22-18-30)41-34(45)12-8-4-6-10-14-36(47)43-51/h15-22,50-51H,3-14,23-28H2,1-2H3,(H,40,44)(H,41,45)(H,42,46)(H,43,47) |
| InChIKey | SSUAXOXNHILDMY-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 209.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.90 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|