C15H21N3O4S — CID 167147307
[4-[5-(carbamoylamino)pentanoylamino]phenyl]methyl 2-sulfanylacetate (PubChem CID 167147307) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is [4-[5-(carbamoylamino)pentanoylamino]phenyl]methyl 2-sulfanylacetate.
| Compound Name | [4-[5-(carbamoylamino)pentanoylamino]phenyl]methyl 2-sulfanylacetate |
|---|---|
| PubChem CID | 167147307 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | [4-[5-(carbamoylamino)pentanoylamino]phenyl]methyl 2-sulfanylacetate |
| SMILES | NC(=O)NCCCCC(=O)Nc1ccc(COC(=O)CS)cc1 |
| InChI | InChI=1S/C15H21N3O4S/c16-15(21)17-8-2-1-3-13(19)18-12-6-4-11(5-7-12)9-22-14(20)10-23/h4-7,23H,1-3,8-10H2,(H,18,19)(H3,16,17,21) |
| InChIKey | OASOEYMQCPZEBZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|