About [4-(5-bromopentanoylamino)phenyl]methyl 5-bromopentanoate
[4-(5-bromopentanoylamino)phenyl]methyl 5-bromopentanoate (PubChem CID 15428588) has the molecular formula C17H23Br2NO3
and a molecular weight of 449.18 g/mol. Its IUPAC name is [4-(5-bromopentanoylamino)phenyl]methyl 5-bromopentanoate.
Molecular Properties
| Compound Name | [4-(5-bromopentanoylamino)phenyl]methyl 5-bromopentanoate |
| PubChem CID | 15428588 |
| Molecular Formula | C17H23Br2NO3 |
| Molecular Weight | 449.18 g/mol |
| Exact Mass | 447.00 |
| IUPAC Name | [4-(5-bromopentanoylamino)phenyl]methyl 5-bromopentanoate |
| SMILES | O=C(CCCCBr)Nc1ccc(COC(=O)CCCCBr)cc1 |
| InChI | InChI=1S/C17H23Br2NO3/c18-11-3-1-5-16(21)20-15-9-7-14(8-10-15)13-23-17(22)6-2-4-12-19/h7-10H,1-6,11-13H2,(H,20,21) |
| InChIKey | MCVQERFJDPYKHE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.18 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [4-(5-bromopentanoylamino)phenyl]methyl 5-bromopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-bromopentanoylamino)phenyl]methyl 5-bromopentanoate?
The IUPAC name of [4-(5-bromopentanoylamino)phenyl]methyl 5-bromopentanoate (CID 15428588) is [4-(5-bromopentanoylamino)phenyl]methyl 5-bromopentanoate.
What is the SMILES notation for [4-(5-bromopentanoylamino)phenyl]methyl 5-bromopentanoate?
The canonical SMILES for [4-(5-bromopentanoylamino)phenyl]methyl 5-bromopentanoate is O=C(CCCCBr)Nc1ccc(COC(=O)CCCCBr)cc1.
What is the InChIKey of [4-(5-bromopentanoylamino)phenyl]methyl 5-bromopentanoate?
The InChIKey is MCVQERFJDPYKHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23Br2NO3/c18-11-3-1-5-16(21)20-15-9-7-14(8-10-15)13-23-17(22)6-2-4-12-19/h7-10H,1-6,11-13H2,(H,20,21).
What are the key properties of [4-(5-bromopentanoylamino)phenyl]methyl 5-bromopentanoate?
[4-(5-bromopentanoylamino)phenyl]methyl 5-bromopentanoate has a molecular weight of 449.18 g/mol, XLogP of 4.80, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-bromopentanoylamino)phenyl]methyl 5-bromopentanoate is sourced from PubChem (CID 15428588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).