C19H20Br2N2O2 — CID 139955588
3-bromo-N-[4-[[4-(3-bromopropanoylamino)phenyl]methyl]phenyl]propanamide (PubChem CID 139955588) has the molecular formula C19H20Br2N2O2 and a molecular weight of 468.19 g/mol. Its IUPAC name is 3-bromo-N-[4-[[4-(3-bromopropanoylamino)phenyl]methyl]phenyl]propanamide.
| Compound Name | 3-bromo-N-[4-[[4-(3-bromopropanoylamino)phenyl]methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 139955588 |
| Molecular Formula | C19H20Br2N2O2 |
| Molecular Weight | 468.19 g/mol |
| Exact Mass | 465.99 |
| IUPAC Name | 3-bromo-N-[4-[[4-(3-bromopropanoylamino)phenyl]methyl]phenyl]propanamide |
| SMILES | O=C(CCBr)Nc1ccc(Cc2ccc(NC(=O)CCBr)cc2)cc1 |
| InChI | InChI=1S/C19H20Br2N2O2/c20-11-9-18(24)22-16-5-1-14(2-6-16)13-15-3-7-17(8-4-15)23-19(25)10-12-21/h1-8H,9-13H2,(H,22,24)(H,23,25) |
| InChIKey | FHKXWNPMXKFMJW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.19 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|