C23H26N2O6 — CID 2835080
methyl 4-[4-[[4-[(4-methoxy-4-oxobutanoyl)amino]phenyl]methyl]anilino]-4-oxobutanoate (PubChem CID 2835080) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is methyl 4-[4-[[4-[(4-methoxy-4-oxobutanoyl)amino]phenyl]methyl]anilino]-4-oxobutanoate.
| Compound Name | methyl 4-[4-[[4-[(4-methoxy-4-oxobutanoyl)amino]phenyl]methyl]anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 2835080 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | methyl 4-[4-[[4-[(4-methoxy-4-oxobutanoyl)amino]phenyl]methyl]anilino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)Nc1ccc(Cc2ccc(NC(=O)CCC(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C23H26N2O6/c1-30-22(28)13-11-20(26)24-18-7-3-16(4-8-18)15-17-5-9-19(10-6-17)25-21(27)12-14-23(29)31-2/h3-10H,11-15H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | LHGLSJWYQRHIIP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |