C24H25F13N2O5 — CID 177438457
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl 2-[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]acetate (PubChem CID 177438457) has the molecular formula C24H25F13N2O5 and a molecular weight of 668.45 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl 2-[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]acetate.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl 2-[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 177438457 |
| Molecular Formula | C24H25F13N2O5 |
| Molecular Weight | 668.45 g/mol |
| Exact Mass | 668.16 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl 2-[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]acetate |
| SMILES | O=C(CCCCCCC(=O)Nc1ccc(CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1)NO |
| InChI | InChI=1S/C24H25F13N2O5/c25-19(26,20(27,28)21(29,30)22(31,32)23(33,34)24(35,36)37)11-12-44-18(42)13-14-7-9-15(10-8-14)38-16(40)5-3-1-2-4-6-17(41)39-43/h7-10,43H,1-6,11-13H2,(H,38,40)(H,39,41) |
| InChIKey | JWNTZIYESGDICF-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.45 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|