C23H36N2O5 — CID 155516196
heptyl 2-[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]acetate (PubChem CID 155516196) has the molecular formula C23H36N2O5 and a molecular weight of 420.55 g/mol. Its IUPAC name is heptyl 2-[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]acetate.
| Compound Name | heptyl 2-[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 155516196 |
| Molecular Formula | C23H36N2O5 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | heptyl 2-[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]acetate |
| SMILES | CCCCCCCOC(=O)Cc1ccc(NC(=O)CCCCCCC(=O)NO)cc1 |
| InChI | InChI=1S/C23H36N2O5/c1-2-3-4-7-10-17-30-23(28)18-19-13-15-20(16-14-19)24-21(26)11-8-5-6-9-12-22(27)25-29/h13-16,29H,2-12,17-18H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | MVOIFPZYAZYDFT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|