C16H22N2O5 — CID 175537934
[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl] acetate (PubChem CID 175537934) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is [4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl] acetate.
| Compound Name | [4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl] acetate |
|---|---|
| PubChem CID | 175537934 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | [4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(NC(=O)CCCCCCC(=O)NO)cc1 |
| InChI | InChI=1S/C16H22N2O5/c1-12(19)23-14-10-8-13(9-11-14)17-15(20)6-4-2-3-5-7-16(21)18-22/h8-11,22H,2-7H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | FUIONVRIKZZSPL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|