C31H43N3O4 — CID 123438550
cyclopentyl (2S)-2-cyclohexyl-2-[[4-[[[4-[3-(hydroxyamino)-3-oxopropyl]phenyl]methylamino]methyl]phenyl]methylamino]acetate (PubChem CID 123438550) has the molecular formula C31H43N3O4 and a molecular weight of 521.70 g/mol. Its IUPAC name is cyclopentyl (2S)-2-cyclohexyl-2-[[4-[[[4-[3-(hydroxyamino)-3-oxopropyl]phenyl]methylamino]methyl]phenyl]methylamino]acetate.
| Compound Name | cyclopentyl (2S)-2-cyclohexyl-2-[[4-[[[4-[3-(hydroxyamino)-3-oxopropyl]phenyl]methylamino]methyl]phenyl]methylamino]acetate |
|---|---|
| PubChem CID | 123438550 |
| Molecular Formula | C31H43N3O4 |
| Molecular Weight | 521.70 g/mol |
| Exact Mass | 521.33 |
| IUPAC Name | cyclopentyl (2S)-2-cyclohexyl-2-[[4-[[[4-[3-(hydroxyamino)-3-oxopropyl]phenyl]methylamino]methyl]phenyl]methylamino]acetate |
| SMILES | O=C(CCc1ccc(CNCc2ccc(CN[C@H](C(=O)OC3CCCC3)C3CCCCC3)cc2)cc1)NO |
| InChI | InChI=1S/C31H43N3O4/c35-29(34-37)19-18-23-10-12-24(13-11-23)20-32-21-25-14-16-26(17-15-25)22-33-30(27-6-2-1-3-7-27)31(36)38-28-8-4-5-9-28/h10-17,27-28,30,32-33,37H,1-9,18-22H2,(H,34,35)/t30-/m0/s1 |
| InChIKey | NQPJGQIJRFAXEZ-PMERELPUSA-N |
| XLogP | 4.94 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.70 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|