C28H44N2O4 — CID 123630020
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-cyclohexyl-2-[[4-[3-(hydroxyamino)-3-oxopropyl]phenyl]methylamino]acetate (PubChem CID 123630020) has the molecular formula C28H44N2O4 and a molecular weight of 472.67 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-cyclohexyl-2-[[4-[3-(hydroxyamino)-3-oxopropyl]phenyl]methylamino]acetate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-cyclohexyl-2-[[4-[3-(hydroxyamino)-3-oxopropyl]phenyl]methylamino]acetate |
|---|---|
| PubChem CID | 123630020 |
| Molecular Formula | C28H44N2O4 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.33 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-cyclohexyl-2-[[4-[3-(hydroxyamino)-3-oxopropyl]phenyl]methylamino]acetate |
| SMILES | CC(C)C1CC[C@@H](C)C[C@H]1OC(=O)[C@@H](NCc1ccc(CCC(=O)NO)cc1)C1CCCCC1 |
| InChI | InChI=1S/C28H44N2O4/c1-19(2)24-15-9-20(3)17-25(24)34-28(32)27(23-7-5-4-6-8-23)29-18-22-12-10-21(11-13-22)14-16-26(31)30-33/h10-13,19-20,23-25,27,29,33H,4-9,14-18H2,1-3H3,(H,30,31)/t20-,24?,25-,27+/m1/s1 |
| InChIKey | WPJVHWXWUFUHAI-VJZSABKVSA-N |
| XLogP | 5.17 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|