C23H34N2O4 — CID 129231029
[(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R)-2-cyclopentyl-2-(2-nitroanilino)acetate (PubChem CID 129231029) has the molecular formula C23H34N2O4 and a molecular weight of 402.54 g/mol. Its IUPAC name is [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R)-2-cyclopentyl-2-(2-nitroanilino)acetate.
| Compound Name | [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R)-2-cyclopentyl-2-(2-nitroanilino)acetate |
|---|---|
| PubChem CID | 129231029 |
| Molecular Formula | C23H34N2O4 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R)-2-cyclopentyl-2-(2-nitroanilino)acetate |
| SMILES | CC(C)C1CC[C@@H](C)C[C@H]1OC(=O)[C@H](Nc1ccccc1[N+](=O)[O-])C1CCCC1 |
| InChI | InChI=1S/C23H34N2O4/c1-15(2)18-13-12-16(3)14-21(18)29-23(26)22(17-8-4-5-9-17)24-19-10-6-7-11-20(19)25(27)28/h6-7,10-11,15-18,21-22,24H,4-5,8-9,12-14H2,1-3H3/t16-,18?,21-,22-/m1/s1 |
| InChIKey | KQFNGIWECLYBCL-DZHRBFKESA-N |
| XLogP | 5.57 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|