About [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-iodophenyl)propanoate
[(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-iodophenyl)propanoate (PubChem CID 135024955) has the molecular formula C19H27IO2
and a molecular weight of 414.33 g/mol. Its IUPAC name is [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-iodophenyl)propanoate.
Molecular Properties
| Compound Name | [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-iodophenyl)propanoate |
| PubChem CID | 135024955 |
| Molecular Formula | C19H27IO2 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-iodophenyl)propanoate |
| SMILES | CC(C(=O)O[C@@H]1C[C@H](C)CCC1C(C)C)c1ccccc1I |
| InChI | InChI=1S/C19H27IO2/c1-12(2)15-10-9-13(3)11-18(15)22-19(21)14(4)16-7-5-6-8-17(16)20/h5-8,12-15,18H,9-11H2,1-4H3/t13-,14?,15?,18-/m1/s1 |
| InChIKey | GZVQVVGWNFYELP-SEVFCGSRSA-N |
| XLogP | 5.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-iodophenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-iodophenyl)propanoate?
The IUPAC name of [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-iodophenyl)propanoate (CID 135024955) is [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-iodophenyl)propanoate.
What is the SMILES notation for [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-iodophenyl)propanoate?
The canonical SMILES for [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-iodophenyl)propanoate is CC(C(=O)O[C@@H]1C[C@H](C)CCC1C(C)C)c1ccccc1I.
What is the InChIKey of [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-iodophenyl)propanoate?
The InChIKey is GZVQVVGWNFYELP-SEVFCGSRSA-N. The full InChI is InChI=1S/C19H27IO2/c1-12(2)15-10-9-13(3)11-18(15)22-19(21)14(4)16-7-5-6-8-17(16)20/h5-8,12-15,18H,9-11H2,1-4H3/t13-,14?,15?,18-/m1/s1.
What are the key properties of [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-iodophenyl)propanoate?
[(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-iodophenyl)propanoate has a molecular weight of 414.33 g/mol, XLogP of 5.40, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-iodophenyl)propanoate is sourced from PubChem (CID 135024955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).